| Identification | Back Directory | [Name]
4,4',4'',4'''-(pyrazine-2,3,5,6-tetrayl)tetrabenzoic acid | [CAS]
2089016-10-2 | [Synonyms]
4,4',4'',4'''-(pyrazine-2,3,5,6-tetrayl)tetrabenzoic acid Benzoic acid, 4,?4',?4'',?4'''-?(2,?3,?5,?6-?pyrazinetetrayl)?tetrakis- | [Molecular Formula]
C32H20N2O8 | [MDL Number]
MFCD32666990 | [MOL File]
2089016-10-2.mol | [Molecular Weight]
560.51 |
| Chemical Properties | Back Directory | [Boiling point ]
777.4±60.0 °C(Predicted) | [density ]
1.447±0.06 g/cm3(Predicted) | [storage temp. ]
Store at room temperature | [pka]
2.81±0.10(Predicted) | [Appearance]
Off-white to light yellow Solid | [InChIKey]
GGNSXWSHZWXCDJ-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=C(C=C2)C(O)=O)=NC(C2=CC=C(C=C2)C(O)=O)=C(C2=CC=C(C=C2)C(O)=O)N=C1C1=CC=C(C=C1)C(O)=O |
| Hazard Information | Back Directory | [Uses]
4,4',4'',4'''-(Pyrazine-2,3,5,6-tetrayl)tetrabenzoic acid is used as a ligand in the synthesis of MOF materials: Zn-TCPP; STA-27; Ni-MOF-1. |
|
| Company Name: |
HongShengBY Gold
|
| Tel: |
15809295147 |
| Website: |
www.chemicalbook.com/contactus_752479.htm |
|