| Identification | Back Directory | [Name]
(2Z,6Z)-N′2,N′6-DICYANOPYRIDINE-2,6-BIS(CARBOXIMIDAMIDE) | [CAS]
2105938-35-8 | [Synonyms]
2,6-Pyridinedicarboximidamide, N2,N6-dicyano- N2,N6-Dicyanopyridine-2,6-bis(carboximidamide) (2Z,6Z)-N′2,N′6-DICYANOPYRIDINE-2,6-BIS(CARBOXIMIDAMIDE) | [Molecular Formula]
C9H7N7 | [MDL Number]
MFCD31731629 | [MOL File]
2105938-35-8.mol | [Molecular Weight]
213.2 |
| Chemical Properties | Back Directory | [Melting point ]
>300°C | [Boiling point ]
371.9±52.0 °C(Predicted) | [density ]
1.41±0.1 g/cm3(Predicted) | [form ]
powder or crystals | [pka]
-1.88±0.50(Predicted) | [InChI]
InChI=1S/C9H7N7/c10-4-14-8(12)6-2-1-3-7(16-6)9(13)15-5-11/h1-3H,(H2,12,14)(H2,13,15) | [InChIKey]
NFCPGRIKBAMXHQ-UHFFFAOYSA-N | [SMILES]
C1(C(NC#N)=N)=NC(C(NC#N)=N)=CC=C1 |
| Hazard Information | Back Directory | [Uses]
This pyridyl carboxamidine ligand has been demonstrated by Daniel Weix′s lab to enable nickel-catalyzed cross-coupling of diverse basic nitrogen heterocycles with primary and secondary alkyl halides. | [reaction suitability]
core: nickel reaction type: Cross Couplings reagent type: catalyst |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|