| Identification | Back Directory | [Name]
(2-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate | [CAS]
210823-54-4 | [Synonyms]
Mesityl(o-tolyl)iodonium triflate Mesityl(o-tolyl)iodonium trifluoromethanesulfonate (2-Methylphenyl)(2,4,6-triMethylphenyl)iodoniuM triflate (2-tolyl) (2,4,6-trimethylphenyl) iodonium trifluoromethanesulfonate (2-Methylphenyl)(2,4,6-trimethylphenyl)iodonium trifluoromethanesulfonate Iodonium, (2-methylphenyl)(2,4,6-trimethylphenyl)-, 1,1,1-trifluoromethanesulfonate (1:1) Iodonium, (2-?methylphenyl)?(2,?4,?6-?trimethylphenyl)?-?, 1,?1,?1-?trifluoromethanesulf?onate (1:1)98.00% | [Molecular Formula]
C17H18F3IO3S | [MDL Number]
MFCD20264884 | [MOL File]
210823-54-4.mol | [Molecular Weight]
486.288 |
| Chemical Properties | Back Directory | [Melting point ]
166.0 to 170.0 °C | [storage temp. ]
2-8°C, sealed storage, away from moisture | [solubility ]
soluble in Methanol | [form ]
powder to crystal | [color ]
White to Light yellow to Light orange | [BRN ]
7965987 | [InChI]
InChI=1S/C16H18I.CHF3O3S/c1-11-9-13(3)16(14(4)10-11)17-15-8-6-5-7-12(15)2;2-1(3,4)8(5,6)7/h5-10H,1-4H3;(H,5,6,7)/q+1;/p-1 | [InChIKey]
QFMYCPNBAGXLDL-UHFFFAOYSA-M | [SMILES]
[I+](C1=CC=CC=C1C)C1=C(C)C=C(C)C=C1C.S(C(F)(F)F)([O-])(=O)=O |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|