| Identification | Back Directory | [Name]
Dapagliflozin Impurity D | [CAS]
2133407-75-5 | [Synonyms]
Dapagliflozin C2 Epimer Dapagliflozin Impurity D Dapagliflozin (C3)-Epimer Dapagliflozin Manno Isomer (S)-5-(2,2-dimethyl-4H-benzo[d][1,3]dioxin-6-yl)oxazolidin-2-one D-Mannitol, 1,5-anhydro-1-C-[4-chloro-3-[(4-ethoxyphenyl)methyl]phenyl]-, (1S)- (2S,3S,4R,5S,6R)-2-(4-Chloro-3-(4-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-3,4,5-triol (3R,4S,5S,6R)-2-(4-chloro-3-(2-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol (2S,3R,4S,5S,6R)-2-(4-chloro-3-(2-ethoxybenzyl)phenyl)-6-(hydroxymethyl)tetrahydro-2H-pyran-2,3,4,5-tetraol | [Molecular Formula]
C21H25ClO6 | [MDL Number]
MFCD34597565 | [MOL File]
2133407-75-5.mol | [Molecular Weight]
408.88 |
| Chemical Properties | Back Directory | [Melting point ]
>67°C (dec.) | [Boiling point ]
609.0±55.0 °C(Predicted) | [density ]
1.349±0.06 g/cm3(Predicted) | [storage temp. ]
Hygroscopic, Refrigerator, under inert atmosphere | [solubility ]
DMSO (Slightly), Methanol (Slightly) | [form ]
Solid | [pka]
13.23±0.70(Predicted) | [color ]
White to Off-White | [Stability:]
Hygroscopic | [InChIKey]
JVHXJTBJCFBINQ-TYUQSVNXNA-N | [SMILES]
O[C@H]1[C@H]([C@H](O)[C@@H](CO)O[C@H]1C1C=CC(Cl)=C(CC2C=CC(OCC)=CC=2)C=1)O |&1:1,2,3,5,9,r| |
| Hazard Information | Back Directory | [Uses]
Dapagliflozin C2 Epimer is an intermediate used in the synthesis of Dapagliflozin (D185370), a sodium-glucose transporter 2 inhibitor. |
|
| Company Name: |
Lynnchem
|
| Tel: |
86-(0)29-85992781 17792393971 |
| Website: |
http://www.lynnchem.com/ |
| Company Name: |
Novachemistry
|
| Tel: |
44-20819178-90 02081917890 |
| Website: |
https://www.novachemistry.com/ |
| Company Name: |
BOC Sciences
|
| Tel: |
|
| Website: |
https://www.bocsci.com |
|