| Identification | Back Directory | [Name]
(3S,5R,6R)-Bupropion Impurity | [CAS]
2133460-43-0 | [Synonyms]
Bupropion Impurity 9
Bupropion Impurity T
Bupropion Impurity 38
Bupropion Impurity 18
Bupropion Impurity (S,R,R)
Bupropion S,R,R,-Thiomorpholine derivative
Bupropion Impurity 9 ((3S,5R,6R)-Bupropion Impurity)
(3S,5R,6R)-6-(3-Chlorophenyl)-6-hydroxy-5-methylthiomorpholine-3-carboxylic Acid
3-Thiomorpholinecarboxylic acid, 6-(3-chlorophenyl)-6-hydroxy-5-methyl-, (3S,5R,6R)-
(3S,5R,6R)-Bupropion ImpurityQ: What is
(3S,5R,6R)-Bupropion Impurity Q: What is the CAS Number of
(3S,5R,6R)-Bupropion Impurity Q: What is the storage condition of
(3S,5R,6R)-Bupropion Impurity Q: What are the applications of
(3S,5R,6R)-Bupropion Impurity | [Molecular Formula]
C12H14ClNO3S | [MOL File]
2133460-43-0.mol | [Molecular Weight]
287.76 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C12H14ClNO3S/c1-7-12(17,8-3-2-4-9(13)5-8)18-6-10(14-7)11(15)16/h2-5,7,10,14,17H,6H2,1H3,(H,15,16)/t7-,10-,12+/m1/s1 | [InChIKey]
NUKIHEHYUSKICU-XXFPWJFMSA-N | [SMILES]
N1[C@H](C)[C@](C2=CC=CC(Cl)=C2)(O)SC[C@@H]1C(O)=O |
|
| Company Name: |
sgtlifesciences pvt ltd
|
| Telephone: |
+91-8790379245 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList1846349/0.htm |
|