| Identification | Back Directory | [Name]
N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide | [CAS]
215726-57-1 | [Synonyms]
4FPEPTC
N,N' -Bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene dicarboximide
N,N'-bis[2-(4-fluoro-phenyl)-ethyl]-3,4,9,10-perylene tetradicarboxiMide
2,9-Bis(4-fluorophenethyl)anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetraone
2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d′e′f′]diisoquinoline-1,3,8,10(2H,9H)tetrone
2,9-Bis[2-(4-fluorophenyl)ethyl]anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)tetrone 95%
Anthra[2,1,9-def:6,5,10-d'e'f']diisoquinoline-1,3,8,10(2H,9H)-tetrone, 2,9-bis[2-(4-fluorophenyl)ethyl]- (9CI) | [Molecular Formula]
C40H24F2N2O4 | [MDL Number]
MFCD22572688 | [MOL File]
215726-57-1.mol | [Molecular Weight]
634.63 |
| Chemical Properties | Back Directory | [Melting point ]
371-376°C | [form ]
solid | [InChIKey]
NTVKTKREOVPUHX-UHFFFAOYSA-N | [SMILES]
Fc1ccc(CCN2C(=O)c3ccc4c5ccc6C(=O)N(CCc7ccc(F)cc7)C(=O)c8ccc(c9ccc(C2=O)c3c49)c5c68)cc1 |
| Safety Data | Back Directory | [Hazard Codes ]
Xn | [Risk Statements ]
22 | [WGK Germany ]
3 | [Storage Class]
13 - Non Combustible Solids | [Hazard Classifications]
Acute Tox. 4 Oral |
| Hazard Information | Back Directory | [Uses]
Used in organic solar cells. | [General Description]
The small molecules of this monomer offers advantages over its polymeric counterparts because
(a) their structures are well defined and exhibit no molecular weight dependence, leading to improved purity and limiting variation; and
(b) they exhibit more organized nanostructures, leading to higher charge carrier mobility.
Additionally, small molecule architectures are sensitive to minute structure changes; thus, properties like electronic energy levels, optical absorption, and self-assembly tendencies can be systemically tuned to maximize device performance. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|