| Identification | Back Directory | [Name]
Dichloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II) | [CAS]
220114-38-5 | [Synonyms]
DM− BINAP][(R,R)− Dichloro{(R)-(+)-2,2' RuCl2[(R)− RuCl2[(R)-DM-BINAP][(R,R)-DPEN] RuCl2[(R)-xylbinap][(R,R)-dpen] -binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II),RuCl2[( Dichloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II) Dichloro{(R)-(+)-2,2'-bis[di(3,5-xylyl)phosphino]-1,1'-binaphthyl}[(1R,2R)-(+)-1,2-diphenylethylenediamine]ruthenium(II) RuCl2[(R)-xylbinap][(R,R)-dpen] | [Molecular Formula]
C66H64Cl2N2P2Ru | [MDL Number]
MFCD09753028 | [MOL File]
220114-38-5.mol | [Molecular Weight]
1119.17 |
| Chemical Properties | Back Directory | [storage temp. ]
2-8°C | [form ]
Powder | [color ]
yellow | [Sensitive ]
air sensitive | [InChIKey]
WCMIEHITLHVXIN-UHFFFAOYSA-N | [SMILES]
Cl[Ru]Cl.N[C@@H]([C@H](N)c1ccccc1)c2ccccc2.Cc3cc(C)cc(c3)P(c4cc(C)cc(C)c4)c5ccc6ccccc6c5-c7c(ccc8ccccc78)P(c9cc(C)cc(C)c9)c%10cc(C)cc(C)c%10 |
| Hazard Information | Back Directory | [Uses]
RuCl2[(R)-DM-BINAP][(R,R)-DPEN] can catalyze the enantioselective asymmetric reduction of benzils to form the corresponding chiral 1,2-diols. | [General Description]
The product is a bis-naphthalene containing phosphine ligand, in conjugation with a ruthenium complex. |
|
| Company Name: |
Evans Fine Chem
|
| Tel: |
+91-9821340302 |
| Website: |
www.evanschem.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
|