| Identification | Back Directory | [Name]
Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester | [CAS]
220621-22-7 | [Synonyms]
FEMA No. 4006
Monomenthyl glutarate
L-MONOMENTHYLGLUTARATE
L-menthylglutaric acid
laevo-monomenthyl glutarate
Monomenthyl glutarate, (-)-
(L)-Monomenthane-3-yl carbonate
Pentanedioic acid,L-Monomenthyl glutarate
5-(((1R,2S,5R)-2-Isopropyl-5-methylcyclohexyl)oxy)-5-oxopentanoic acid
Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester
220621-22-7 Pentanedioic acid, 1-[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester | [Molecular Formula]
C15H26O4 | [MDL Number]
MFCD13194764 | [MOL File]
220621-22-7.mol | [Molecular Weight]
270.36 |
| Chemical Properties | Back Directory | [Boiling point ]
393.4±25.0 °C(Predicted) | [density ]
1.0318 | [FEMA ]
4006 | L-MONOMENTHYL GLUTARATE | [pka]
4.61±0.10(Predicted) | [Odor]
minty menthol | [Odor Type]
minty | [JECFA Number]
1414 | [Major Application]
flavors and fragrances | [InChI]
InChI=1S/C15H26O4/c1-10(2)12-8-7-11(3)9-13(12)19-15(18)6-4-5-14(16)17/h10-13H,4-9H2,1-3H3,(H,16,17)/t11-,12+,13-/m1/s1 | [InChIKey]
CTMTYSVTTGVYAW-FRRDWIJNSA-N | [SMILES]
C(O[C@@H]1C[C@H](C)CC[C@H]1C(C)C)(=O)CCCC(O)=O | [LogP]
3.96 |
| Hazard Information | Back Directory | [Uses]
flavors and fragrances | [Synthesis]
A solvent-free reaction to obtain glutaric acid mono-L-menthane ester from glutaric anhydride and menthol, using artificial zeolite as a catalyst, by adding solvent to solubilize, warming up, and then removing the solvent under reduced pressure.
|
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
| Company Name: |
Shanghai UCHEM Inc.
|
| Telephone: |
+86-18930848214 +86-021-56762820 |
| Website: |
http://www.myuchem.com/ |
|