| Identification | Back Directory | [Name]
SIMAZINE D10 | [CAS]
220621-39-6 | [Synonyms]
SIMAZINE D10 D10-Simazine Simazine-d10 SIMAZINE-D10 (DIETHYL-D10) 2,4-BIS(PENTADEUTEROETHYLAMINO)-6-CHLORO-1,3,5-TRIAZINE 6-chloro-2-N,4-N-bis(1,1,2,2,2-pentadeuterioethyl)-1,3,5-triazine-2,4-diamine Simazine D10Q: What is
Simazine D10 Q: What is the CAS Number of
Simazine D10 Q: What is the storage condition of
Simazine D10 Q: What are the applications of
Simazine D10 | [Molecular Formula]
C7H2ClD10N5 | [MDL Number]
MFCD01632307 | [MOL File]
220621-39-6.mol | [Molecular Weight]
211.72 |
| Chemical Properties | Back Directory | [storage temp. ]
0-6°C | [solubility ]
DMF: slightly soluble,DMSO: slightly soluble | [form ]
neat | [Stability:]
Hygroscopic | [Major Application]
agriculture environmental | [InChI]
1S/C7H12ClN5/c1-3-9-6-11-5(8)12-7(13-6)10-4-2/h3-4H2,1-2H3,(H2,9,10,11,12,13)/i1D3,2D3,3D2,4D2 | [InChIKey]
ODCWYMIRDDJXKW-MWUKXHIBSA-N | [SMILES]
[2H]C([2H])([2H])C([2H])([2H])Nc1nc(Cl)nc(NC([2H])([2H])C([2H])([2H])[2H])n1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|