| Identification | Back Directory | [Name]
Diquafosol Impurity UP2U | [CAS]
221169-12-6 | [Synonyms]
Diquafosol Impurity UP2 Diquafosol Impurity UP2U Diquafosol Impurity U2P2 P1, P2-Di(Uridine-5')-Diphosphate Disodium | [Molecular Formula]
C18H25N4NaO17P2 | [MOL File]
221169-12-6.mol | [Molecular Weight]
654.35 |
| Chemical Properties | Back Directory | [InChIKey]
MHNZGPRHGIOSIZ-NIBQMMLDNA-N | [SMILES]
O[C@@H]1[C@@H]([C@@H](COP(O)(=O)OP(O)(=O)OC[C@@H]2[C@H]([C@@H](O)[C@H](N3C=CC(=O)NC3=O)O2)O)O[C@H]1N1C=CC(=O)NC1=O)O.[NaH] |&1:1,2,3,15,16,17,19,31,r| |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
|