| Identification | Back Directory | [Name]
(±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide | [CAS]
22568-64-5 | [Synonyms]
M and B 16942 rac Diacetolol (+-)-Diacetolol Acebutolol Impurity 2 Acebutolol EP IMpurity B Acebutolol Impurity B HCl Acebutolol EP Impurity B HCl Acebutolol Impurity 2 Monomer DL-3'-Acetyl-4'-[2-hydroxy-3-(isopropylaMino)propoxy]acetanilide 1-(4-AcetaMido-2-acetylphenoxy)-2-hydroxy-3-isopropylaMinopropane N-(3-acetyl-4-{2-hydroxy-3-[(propan-2-yl)amino]pr opoxy}phenyl)acetamide (±)-N-[3-acetyl-4-[2-hydroxy-3-[(1-methylethyl)amino]propoxy]phenyl]acetamide N-{3-Acetyl-4-{(2RS)-2-hydroxy-3-[(1-methylethyl)amino]propoxy}phenyl}acetamide N-[3-acetyl-4-[(2RS)-2-hydroxy-3-[(1-methylethyl) amino] propoxy] phenyl] acetamide hydrochloride Acebutolol Related Compound B (N-{3-Acetyl-4-[2-hydroxy-3-(isopropylamino)propoxy]phenyl}acetamide) (1000623) Rac DiacetololQ: What is
Rac Diacetolol Q: What is the CAS Number of
Rac Diacetolol Q: What is the storage condition of
Rac Diacetolol Q: What are the applications of
Rac Diacetolol | [EINECS(EC#)]
245-088-3 | [Molecular Formula]
C16H24N2O4 | [MDL Number]
MFCD00864561 | [MOL File]
22568-64-5.mol | [Molecular Weight]
308.37 |
| Chemical Properties | Back Directory | [Melting point ]
128 - 131°C | [storage temp. ]
Refrigerator, under inert atmosphere | [solubility ]
Chloroform (Very Slightly), DMSO (Slightly), Methanol (Slightly) | [form ]
neat | [color ]
Off-White to Light Yellow | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C16H24N2O4/c1-10(2)17-8-14(21)9-22-16-6-5-13(18-12(4)20)7-15(16)11(3)19/h5-7,10,14,17,21H,8-9H2,1-4H3,(H,18,20) | [InChIKey]
AWOGXJOBNAWQSF-UHFFFAOYSA-N | [SMILES]
N(C(C)C)CC(O)COc1c(cc(cc1)NC(=O)C)C(=O)C |
| Hazard Information | Back Directory | [Uses]
The principal metabolite of Acebutolol (A123800) with less β-adrenoceptor blocking potency but greater cardioselectivity (atrial relative to tracheal tissue). | [Uses]
The principal metabolite of Acebutolol (A123800) with less β-adrenoceptor blocking potency but greater cardioselectivity (atrial relative to tracheal tissue. Acebutolol EP Impurity B. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|