| Identification | Back Directory | [Name]
IODODIOXOBIS(TRIPHENYLPHOSPHINE)RHENIUM(V) | [CAS]
23032-93-1 | [Synonyms]
Iododioxobis(triphenylphosphine)rhenium IODODIOXOBIS(TRIPHENYLPHOSPHINE)RHENIUM(V) Iododioxobis(triphenylphosphine)rhenium(V),98% | [Molecular Formula]
C36H30IO2P2Re | [MDL Number]
MFCD00151571 | [MOL File]
23032-93-1.mol | [Molecular Weight]
869.68 |
| Chemical Properties | Back Directory | [Melting point ]
195-197 °C(lit.)
| [form ]
crystal | [color ]
violet | [InChI]
1S/2C18H15P.HI.2O.Re/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;;;;/h2*1-15H;1H;;;/q;;;;;+1/p-1 | [InChIKey]
PMWGPGWRMJAPNT-UHFFFAOYSA-M | [SMILES]
I[Re](=O)=O.c1ccc(cc1)P(c2ccccc2)c3ccccc3.c4ccc(cc4)P(c5ccccc5)c6ccccc6 |
| Questions And Answer | Back Directory | [Uses]
Iododioxobis(triphenylphosphine)rhenium(V) can be useful catalyst for the ortho-deuteration of anilines, benzylamines, nitrogen heterocycles and functionalized aromatics, in the chemoselective, hydrosilylation of aldehydes and ketones.
|
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
SIGMA-RBI
|
| Tel: |
800 736 3690 (Orders) |
| Website: |
www.sigma-aldrich.com |
|