| Identification | Back Directory | [Name]
Methyl 4-(acetylaMino)-3-broMo-5-chloro-2-hydroxybenzoate | [CAS]
232941-14-9 | [Synonyms]
methyl 4-acetamido-3-bromo-5-chloro-2-hydroxy-benzoate Methyl 4-(acetylaMino)-3-broMo-5-chloro-2-hydroxybenzoate Benzoic acid, 4-(acetylamino)-3-bromo-5-chloro-2-hydroxy-, methyl ester Prucalopride Impurity 38Q: What is
Prucalopride Impurity 38 Q: What is the CAS Number of
Prucalopride Impurity 38 | [Molecular Formula]
C10H9BrClNO4 | [MOL File]
232941-14-9.mol | [Molecular Weight]
322.54 |
| Chemical Properties | Back Directory | [Boiling point ]
421.7±45.0 °C(Predicted) | [density ]
1.725±0.06 g/cm3(Predicted) | [pka]
7.34±0.28(Predicted) | [InChI]
InChI=1S/C10H9BrClNO4/c1-4(14)13-8-6(12)3-5(10(16)17-2)9(15)7(8)11/h3,15H,1-2H3,(H,13,14) | [InChIKey]
JVHHLYLHOXWORE-UHFFFAOYSA-N | [SMILES]
C(OC)(=O)C1=CC(Cl)=C(NC(C)=O)C(Br)=C1O |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
SIMAGCHEM CORP
|
| Telephone: |
+86-5922680277 +86-13806087780 |
| Website: |
http://www.simagchem.com/ |
|