| Identification | Back Directory | [Name]
2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester | [CAS]
23429-04-1 | [Synonyms]
Vitamin B6 Impurity 12 Vitamin B6 Impurity 94 ethyl 5-ethoxy-4-methyloxazole-2-carboxylate ethyl 5-ethoxy-4-methyl-1,3-oxazole-2-carboxylate 2-Oxazolecarboxylic acid, 5-ethoxy-4-methyl-, ethyl ester | [Molecular Formula]
C9H13NO4 | [MDL Number]
MFCD01111980 | [MOL File]
23429-04-1.mol | [Molecular Weight]
199.2 |
| Chemical Properties | Back Directory | [Boiling point ]
128 °C(Press: 4 Torr) | [density ]
1.127±0.06 g/cm3(Predicted) | [pka]
-0.93±0.14(Predicted) | [InChI]
InChI=1S/C9H13NO4/c1-4-12-8(11)7-10-6(3)9(14-7)13-5-2/h4-5H2,1-3H3 | [InChIKey]
PQRKGFMROBZFIM-UHFFFAOYSA-N | [SMILES]
O1C(OCC)=C(C)N=C1C(OCC)=O |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
020-61855200 13326451905 |
| Website: |
www.toref.cn/ |
| Company Name: |
guoyungurui
|
| Tel: |
18162595016; 18162595016 |
| Website: |
https://www.chemicalbook.com/supplier/25521782/ |
|