| Chemical Properties | Back Directory | [Melting point ]
170 °C | [density ]
1.39±0.1 g/cm3(Predicted) | [storage temp. ]
-20°C | [form ]
solid | [pka]
13.90±0.40(Predicted) | [color ]
Off-white to light yellow | [InChIKey]
WXAMRLAFOFNACR-VTJXTUSFSA-N | [SMILES]
S1[C@H]([C@H]4NC(=O)N[C@H]4C1)CCCCC(=O)NCCOCCOCCOCCNC(=O)CCCOc2c(cc(c(c2)[N+](=O)[O-])C(OC(=O)ON3C(=O)CCC3=O)C)OC |
| Hazard Information | Back Directory | [Description]
PC Biotin-PEG3-NHS carbonate ester is a unique amine reactive, photocleavable biotin reagent that allows for reagent-free release of the captured biomolecules from streptavidin beads. This reagent contains a biotin moiety linked to the amine reactive N-hydroxysuccinimidyl (NHS) mixed carbonate through a spacer arm containing a photocleavable moiety. The NHS portion of this compound reacts specifically with primary amine groups on the target molecule(s) to form a carbamate linkage. Captured biomolecules can be efficiently photoreleased, typically >90% in 5-25 minutes using an inexpensive, near-UV, low intensity lamp (e.g. 365 nm lamp at 1-5 mW/cm2). | [Uses]
PC biotin-NHS ester is a unique amine-reactive, photocleavable biotin reagent that allows for reagent-free release of the captured biomolecules from streptavidin. This reagent contains a biotin moiety linked to the amine reactive N-hydroxysuccinimidyl (NHS) mixed carbonate through a spacer arm containing a photocleavable moiety. The NHS portion of this compound reacts specifically with primary amine groups on the target molecule(s) to form a carbamate linkage. Captured biomolecules can be efficiently photoreleased, typically >90% in 5-25 minutes using an inexpensive, near-UV, low intensity lamp (e.g. 365 nm lamp at 1-5 mW/cm2). | [reaction suitability]
reaction type: click chemistry reagent type: cross-linking reagent | [IC 50]
Cleavable Linker |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|