| Identification | Back Directory | [Name]
L-Tryptophan, 1-[(1,1-dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-5-fluoro- | [CAS]
2384196-65-8 | [Synonyms]
Fmoc-5-F-Trp(Boc)-OH
N-Fmoc-1-Boc-5-fluoro-L-tryptophan
L-Tryptophan, 1-[(1,1-dimethylethoxy)carbonyl]-N-[(9H-fluoren-9-ylmethoxy)carbonyl]-5-fluoro- | [Molecular Formula]
C31H29FN2O6 | [MOL File]
2384196-65-8.mol | [Molecular Weight]
544.57 |
| Chemical Properties | Back Directory | [density ]
1.32±0.1 g/cm3(Predicted) | [pka]
3+-.0.10(Predicted) | [InChIKey]
BCORCUAKHUNXBE-SANMLTNESA-N | [SMILES]
C(O)(=O)[C@H](CC1C2=C(C=CC(F)=C2)N(C(OC(C)(C)C)=O)C=1)NC(OCC1C2=C(C=CC=C2)C2=C1C=CC=C2)=O |
| Hazard Information | Back Directory | [Uses]
Fmoc-5-F-Trp(Boc)-OH is a specialised amino acid building block used in solid-phase peptide synthesis (SPPS). It possesses a 5-fluoro substituent on the indole ring, which may influence the molecule’s hydrophobicity, binding behaviour and biological activity. Its molecular structure also contains Fmoc and Boc protective groups. The Fmoc group protects the α-amino group of the amino acid and can generally be removed under basic conditions; it is a commonly used protecting group in Fmoc solid-phase peptide synthesis (SPPS). The Boc (tert-butoxycarbonyl) group protects the nitrogen atom on the indole ring, helping to minimise side reactions that may occur during peptide synthesis and subsequent processing. |
|
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
|