| Identification | Back Directory | [Name]
5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine | [CAS]
24514-56-5 | [Synonyms]
5′-Chloro-2′,3′-isopropylidene adenosine 5'-Chloro-2',3'-isopropylidene adenosine 97% 5′-Chloro-5′-deoxy-2′,3′-O-isopropylideneadenosine 5′-Chloro-5′-deoxy-2′,3′-O-(1-methylethylidene)adenosine Adenosine,5′-chloro-5′-deoxy-2′,3′-O-(1-methylethylidene)- Adenosine, 5'-chloro-5'-deoxy-2',3'-O-(1-methylethylidene)- (9CI) | [Molecular Formula]
C13H16ClN5O3 | [MDL Number]
MFCD23160649 | [MOL File]
24514-56-5.mol | [Molecular Weight]
325.75 |
| Chemical Properties | Back Directory | [Melting point ]
180-182°C | [storage temp. ]
2-8°C | [solubility ]
Dichloromethane, Methanol | [form ]
Solid | [color ]
Off White | [InChI]
1S/C13H16ClN5O3/c1-13(2)21-8-6(3-14)20-12(9(8)22-13)19-5-18-7-10(15)16-4-17-11(7)19/h4-6,8-9,12H,3H2,1-2H3,(H2,15,16,17)/t6-,8-,9-,12-/m1/s1 | [InChIKey]
RWTKKXHFQYWSKL-WOUKDFQISA-N | [SMILES]
CC1(C)O[C@@H]2[C@@H](CCl)O[C@H]([C@@H]2O1)n3cnc4c(N)ncnc34 |
| Hazard Information | Back Directory | [Uses]
5''-Chloro-5''-deoxy-2'',3''-O-isopropylideneadenosine is an intermediate in the synthesis of S-(5''-Adenosyl)-L-homocysteine which is a novel biomarker for predicting susceptibility of a subject to a mental or neurodegenerative disorder. | [Uses]
Versatile nucleoside intermediate. |
|
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
NewCan Biotech Limited
|
| Telephone: |
+86-571-86912261 19975279805 |
| Website: |
https://www.newcanbio.com/ |
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
|