| Identification | Back Directory | [Name]
BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) | [CAS]
251567-28-9 | [Synonyms]
[Pd(NCOC2H4CO)(PPh3)2Br] BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) bromo(n-succinimidyl)bis(triphenylphosphine)palladium(ii) trans-Bromo(N-succinimidyl)bis(triphenylphosphine)palladium(II) bromopalladium, pyrrolidin-1-ide-2,5-dione, triphenylphospho... trans-BroMo(N-succiniMidyl)bis(triphenylphosphine)palladiuM(II),97% BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) BROMOBIS(PH3P)(N-SUCCINIMIDE)PD(II) | [Molecular Formula]
C40H37BrNO2P2Pd | [MDL Number]
MFCD06411335 | [MOL File]
251567-28-9.mol | [Molecular Weight]
812.01 |
| Chemical Properties | Back Directory | [Melting point ]
223-228 °C (dec.) (lit.) | [form ]
solid | [InChI]
1S/2C18H15P.C4H5NO2.BrH.Pd/c2*1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;6-3-1-2-4(7)5-3;;/h2*1-15H;1-2H2,(H,5,6,7);1H;/q;;;;+2/p-2 | [InChIKey]
KYQYWUJRFOCJEW-UHFFFAOYSA-L | [SMILES]
Br[Pd]N1C(=O)CCC1=O.c2ccc(cc2)P(c3ccccc3)c4ccccc4.c5ccc(cc5)P(c6ccccc6)c7ccccc7 |
| Hazard Information | Back Directory | [Uses]
trans-Bromo(N-succinimidyl)bis(triphenylphosphine)palladium(II) may be used in the following processes:
- As a catalyst for the preparation of 6-cyano-2-(3-fluoro-benzyl)-indole-1-carboxylic acid tert-butyl ester via Suzuki cross-coupling reaction between 1-boc-6-cyanoindole-2-boronic acid and 3-fluorobenzyl bromide. This method does not involve the use of strong bases or toxic reagents and also the use of this catalyst minimizes protodeboronation.
- As a precatalyst for the Suzuki-Miyaura cross-coupling reaction between alkenyl tosylates and alkenyl MIDA boronates in the absence of phosphine ligands. For less activated alkenyl tosylate, the addition of tricyclohexylphosphine tetrafluoroborate improves the reactivity.
| [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|