| Identification | Back Directory | [Name]
TINIDAZOLE RELATED COMPOUND B (20 MG) (1-(2-ETHYL-SULFONYLETHYL)-2-METHYL-4-NITROIMIDAZOLE) | [CAS]
25459-12-5 | [Synonyms]
TINIDAZOLE EP IMP B Tinidazole impurity 03 Tinidazole EP Impurity B Tinidazole impurity B CRS Tinidazole Related CoMpound B Tinidazole USP Related Compound B Tinidazole EP Impurity B (USP RC B) Tinidazole Related Compound B (R07290) Tinidazole Impurity 2(Tinidazole EP Impurity B) 1-(2-ethylsulfonylethyl)-2-methyl-4-nitroimidazole 1-[2-(Ethylsulphonyl)ethyl]-2-methyl-4-nitro-1H-imidazole 1H-Imidazole, 1-[2-(ethylsulfonyl)ethyl]-2-methyl-4-nitro- 1-(2-(Ethylsulfonyl)ethyl)-2-methyl-4-nitro-1H-imidazole (Tinidazole Impurity) TINIDAZOLE RELATED COMPOUND B (20 MG) (1-(2-ETHYL-SULFONYLETHYL)-2-METHYL-4-NITROIMIDAZOLE) Tinidazole Related Compound B (1-(2-ethyl-sulfonylethyl)-2-methyl-4-nitroimidazole) (1667541) Tinidazole EP Impurity BQ: What is
Tinidazole EP Impurity B Q: What is the CAS Number of
Tinidazole EP Impurity B Q: What is the storage condition of
Tinidazole EP Impurity B Q: What are the applications of
Tinidazole EP Impurity B | [Molecular Formula]
C8H13N3O4S | [MDL Number]
MFCD01880401 | [MOL File]
25459-12-5.mol | [Molecular Weight]
247.27 |
| Chemical Properties | Back Directory | [Melting point ]
136-139 °C | [Boiling point ]
528.4±30.0 °C(Predicted) | [density ]
1.43±0.1 g/cm3(Predicted) | [storage temp. ]
2-8°C | [solubility ]
DMSO (Slightly) | [pka]
0.78±0.60(Predicted) | [Major Application]
pharmaceutical (small molecule) | [InChI]
1S/C8H13N3O4S/c1-3-16(14,15)5-4-10-6-8(11(12)13)9-7(10)2/h6H,3-5H2,1-2H3 | [InChIKey]
GHJQUSZGINOURI-UHFFFAOYSA-N | [SMILES]
[S](=O)(=O)(CC[n]1c(nc(c1)[N+](=O)[O-])C)CC |
| Hazard Information | Back Directory | [Uses]
4-Nitro-5-desnitro Tinidazole (Tinidazole EP Impurity B) is an impurity in the synthesis of Tinidazole (T443900), antiprotozoal (Trichomonas, Giardia); antiamebic; antibacterial. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
|