| Identification | Back Directory | [Name]
4-NITRO-N-PROPYLBENZAMIDE | [CAS]
2585-24-2 | [Synonyms]
BUTTPARK 74\02-32 TIMTEC-BB SBB009979 4-NITRO-N-PROPYLBENZAMIDE Benzamide, 4-nitro-N-propyl- 4-Nitro-N-n-propylbenzaMide, 97% | [Molecular Formula]
C10H12N2O3 | [MDL Number]
MFCD00024716 | [MOL File]
2585-24-2.mol | [Molecular Weight]
208.21 |
| Chemical Properties | Back Directory | [Melting point ]
100-103 °C (dec.)(lit.)
| [Boiling point ]
395.8±25.0 °C(Predicted) | [density ]
1.192±0.06 g/cm3(Predicted) | [form ]
solid | [pka]
13?+-.0.46(Predicted) | [InChI]
1S/C10H12N2O3/c1-2-7-11-10(13)8-3-5-9(6-4-8)12(14)15/h3-6H,2,7H2,1H3,(H,11,13) | [InChIKey]
MDRVSZJDSUDYGP-UHFFFAOYSA-N | [SMILES]
CCCNC(=O)c1ccc(cc1)[N+]([O-])=O |
| Hazard Information | Back Directory | [Uses]
4-Nitro-N-propylbenzamide may be used in the synthesis of 4-amino-N-substituted amines by catalytic hydrogenation. | [General Description]
4-Nitro-N-propylbenzamide ((4-nitrophenyl)-N-propylcarboxamide) is a benzamide derivative. It can be synthesized by the reaction of 4-nitrobenzoyl chloride and amine. |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
A.J Chemicals
|
| Tel: |
91-9810153283 |
| Website: |
www.ajchemicals.com |
|