| Identification | Back Directory | [Name]
1,10-DIACETOXYDECANE | [CAS]
26118-61-6 | [Synonyms]
1,10-DIACETOXYDECANE DECAMETHYLENE DIACETATE 1,10-Diacetoxydecane> 1,10-DECANEDIOL DIACETATE decane-1,10-diyl diacetate 1,10-Decanediol, 1,10-diacetate Bisacetic acid 1,10-decanediyl ester Diacetic acid decane-1,10-diyl ester Decamethylene Diacetate
1,10-Decanediol Diacetate | [EINECS(EC#)]
247-471-0 | [Molecular Formula]
C14H26O4 | [MDL Number]
MFCD03093628 | [MOL File]
26118-61-6.mol | [Molecular Weight]
258.35 |
| Chemical Properties | Back Directory | [Melting point ]
26 °C | [Boiling point ]
146-150 °C(Press: 2 Torr) | [density ]
0.969±0.06 g/cm3(Predicted) | [Fp ]
26 °C | [form ]
powder to lump to clear liquid | [color ]
White or Colorless to Almost white or Almost colorless | [InChI]
1S/C14H26O4/c1-13(15)17-11-9-7-5-3-4-6-8-10-12-18-14(2)16/h3-12H2,1-2H3 | [InChIKey]
NMOLZWLFORPIME-UHFFFAOYSA-N | [SMILES]
O(CCCCCCCCCCOC(=O)C)C(=O)C | [EPA Substance Registry System]
1,10-Decanediol, diacetate (26118-61-6) |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Maya High Purity Chemicals
|
| Tel: |
+86 (573) 82222445 (0)18006601000 452520369 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15221/0_EN.htm |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
|