| Identification | Back Directory | [Name]
INS(1,2,3,5,6)P5 | [CAS]
26326-85-2 | [Synonyms]
INS(1,2,3,5,6)P5 D-myo-Inositol 1,2,3,5,6-pentaphosphate D-MYO-INOSITOL-1,2,3,5,6-PENTAKISPHOSPHATE L-myo-Inositol 1,2,3,4,5-pentakis-phosphate myo-D-Inositol pentakis(dihydrogen phosphate) L-myo-Inositol 1,2,3,4,5-pentakis(dihydrogen phosphate) D-myo-Inositol, 1,2,3,5,6-pentakis(dihydrogen phosphate) | [Molecular Formula]
C6H17O21P5 | [MDL Number]
MFCD08061883 | [MOL File]
26326-85-2.mol | [Molecular Weight]
580.06 |
| Chemical Properties | Back Directory | [storage temp. ]
-20°C | [InChIKey]
CTPQAXVNYGZUAJ-UOTPTPDRSA-N | [SMILES]
O[C@@H]1[C@@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@@H](OP(O)(O)=O)[C@H](OP(O)(O)=O)[C@H]1OP(O)(O)=O |
| Hazard Information | Back Directory | [Uses]
myo-Inositol 1,2,3,5,6-pentakisphosphate regulates RNA polymerase I-mediated rRNA transcription in Saccharomyces cerevisiae. | [Definition]
ChEBI: D-myo-inositol-1,2,3,5,6-pentaphosphate is an inositol phosphate. | [General Description]
Aluminum was shown to increase the activity of multiple inositol polyphosphate phosphatathase(MIPP) in hepatic mammalian cells. This cased a decrease in the MIPP substrate, Ins(1,2,3,5,6)P5. | [Biochem/physiol Actions]
The metabolite inositol is a precursor of inositides, which have an important impact on diverse areas of cellular regulation. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Carbosynth
|
| Tel: |
+86 512 6260 5585 |
| Website: |
www.carbosynth.com |
| Company Name: |
Fluorochem Ltd
|
| Tel: |
(01457) 868921 (4 lines) |
| Website: |
www.fluorochem.co.uk |
| Company Name: |
Fluorochem Ltd.
|
| Tel: |
+44 1457 868921 |
| Website: |
www.fluorochem.net |
|