| Identification | Back Directory | [Name]
3-Mercaptobutyric acid | [CAS]
26473-49-4 | [Synonyms]
3-Mercaptobutyric acid 3-SULFANYLBUTANOIC ACID Butanoic acid, 3-mercapto- | [EINECS(EC#)]
631-085-8 | [Molecular Formula]
C4H8O2S | [MOL File]
26473-49-4.mol | [Molecular Weight]
120.17 |
| Chemical Properties | Back Directory | [Boiling point ]
194.19°C (rough estimate) | [density ]
1.1371 | [refractive index ]
1.4782 (estimate) | [pka]
4.30±0.10(Predicted) | [InChI]
InChI=1S/C4H8O2S/c1-3(7)2-4(5)6/h3,7H,2H2,1H3,(H,5,6) | [InChIKey]
RQPNXPWEGVCPCX-UHFFFAOYSA-N | [SMILES]
C(O)(=O)CC(S)C |
| Hazard Information | Back Directory | [Pharmaceutical Applications]
As a precursor, 3-Mercaptobutyric acid is used in the synthesis of
pharmaceuticals. Its ability to form covalent bonds with other molecules
makes it a valuable component in the development of new drugs. |
|
|