| Identification | Back Directory | [Name]
N-[BIS(METHYLTHIO)METHYLENE]-P-TOLUENESULFONAMIDE | [CAS]
2651-15-2 | [Synonyms]
Dimethyl tosylcarbonimidodithioate Bismethylthiomethylenetoluenesulfonamide N-[BIS(METHYLTHIO)METHYLENE]-N-TOSYLAMINE N-[BIS(METHYLTHIO)METHYLENE]-P-TOLUENESULFONAMIDE N-(bis(methylthio)methylene)-P-toluene-sulfonamid N-[bis(methylthio)methylene]-4-methyl-benzenesulfonamide N-[bis(methylsulfanyl)methylidene]-4-methylbenzenesulfonamide N-[bis(methylsulfanyl)methylidene]-4-methyl-benzenesulfonamide N-[Bis(methylthio)methylene]-p-toluenesulfonamide N-(4-Methylphenylsulfonyl)imidodithiocarbonic acid dimethyl ester | [Molecular Formula]
C10H13NO2S3 | [MDL Number]
MFCD00144854 | [MOL File]
2651-15-2.mol | [Molecular Weight]
275.41 |
| Chemical Properties | Back Directory | [Melting point ]
109-111 °C(lit.)
| [Boiling point ]
419.0±38.0 °C(Predicted) | [density ]
1.27±0.1 g/cm3(Predicted) | [form ]
powder to crystal | [pka]
-6.63±0.50(Predicted) | [color ]
White to Almost white | [InChI]
InChI=1S/C10H13NO2S3/c1-8-4-6-9(7-5-8)16(12,13)11-10(14-2)15-3/h4-7H,1-3H3 | [InChIKey]
OWIPGZGAUSIOAX-UHFFFAOYSA-N | [SMILES]
C1(S(/N=C(\SC)/SC)(=O)=O)=CC=C(C)C=C1 |
|
| Company Name: |
Energy Chemical
|
| Tel: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
|