| Identification | Back Directory | [Name]
N-Nitroso Venlafaxine EP Impurity DQ: What is
N-Nitroso Venlafaxine EP Impurity D Q: What is the CAS Number of
N-Nitroso Venlafaxine EP Impurity D | [CAS]
2680662-11-5 | [Synonyms]
N-Nitroso Venlafaxine EP Impurity D
N-Nitroso Venlafaxine EP Impurity D (N-Nitroso Venlafaxine USP Related Compound A (Free Form), N-Nitroso-N-Desmethyl Venlafaxine)
N-Nitroso Venlafaxine EP Impurity DQ: What is
N-Nitroso Venlafaxine EP Impurity D Q: What is the CAS Number of
N-Nitroso Venlafaxine EP Impurity D | [Molecular Formula]
C16H24N2O3 | [MOL File]
2680662-11-5.mol | [Molecular Weight]
292.38 |
| Chemical Properties | Back Directory | [InChI]
InChI=1S/C16H24N2O3/c1-18(17-20)12-15(16(19)10-4-3-5-11-16)13-6-8-14(21-2)9-7-13/h6-9,15,19H,3-5,10-12H2,1-2H3 | [InChIKey]
ZSUCJRRVTCFTNC-UHFFFAOYSA-N | [SMILES]
C(C1C=CC(OC)=CC=1)(C1(CCCCC1)O)CN(C)N=O |
|
| Company Name: |
TOSUN PHARM
|
| Tel: |
61855200 13326451905 |
| Website: |
www.toref.cn/ |
|