| Identification | Back Directory | [Name]
2,6-Dichloro-1,5-naphthyridine | [CAS]
27017-66-9 | [Synonyms]
2,6-Dichloro-1,5-naphthyridine 1,5-Naphthyridine, 2,6-dichloro- | [Molecular Formula]
C8H4Cl2N2 | [MDL Number]
MFCD03931483 | [MOL File]
27017-66-9.mol | [Molecular Weight]
199.04 |
| Chemical Properties | Back Directory | [Melting point ]
236-238 °C | [Boiling point ]
299.8±35.0 °C(Predicted) | [density ]
1.486±0.06 g/cm3(Predicted) | [storage temp. ]
Sealed in dry,2-8°C | [pka]
-0.45±0.10(Predicted) | [InChI]
InChI=1S/C8H4Cl2N2/c9-7-3-1-5-6(12-7)2-4-8(10)11-5/h1-4H | [InChIKey]
GMQKLOANTBSSHU-UHFFFAOYSA-N | [SMILES]
N1C2C(=NC(Cl)=CC=2)C=CC=1Cl |
| Hazard Information | Back Directory | [Uses]
2,?6-?Dichloro-?1,?5-?naphthyridine is a reagent used in the preparation of potential tau pathology PET tracers in the treatment of Alzheimer’s disease. |
|
| Company Name: |
Jia Xing Isenchem Co.,Ltd
|
| Tel: |
0573-85285100 18627885956 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList14265/0_EN.htm |
| Company Name: |
T&W GROUP
|
| Tel: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Cochemical Ltd.
|
| Tel: |
029-86115547 17791676824 |
| Website: |
http://www.cochemical.com |
|