| Identification | Back Directory | [Name]
2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) | [CAS]
27280-85-9 | [Synonyms]
VB6-AKG conductase Pyriglutine Pyridoxine α-ketoglutarate (5-chloro-1-benzothiophen-2-yl)methylurea (5-Hydroxy-6-Methylpyridine-3,4-diyl)diMethanol 2-oxopentanedioate 2-oxoglutaric acid, compound with 5-hydroxy-6-methylpyridine-3,4-dimethanol (1:1) | [EINECS(EC#)]
248-386-1 | [Molecular Formula]
C8H11NO3.C5H6O5 | [MDL Number]
MFCD00239524 | [MOL File]
27280-85-9.mol | [Molecular Weight]
315.276 |
| Chemical Properties | Back Directory | [Melting point ]
120.5-121.5 °C | [storage temp. ]
2-8°C | [InChI]
InChI=1S/C8H11NO3.C5H6O5/c1-5-8(12)7(4-11)6(3-10)2-9-5;6-3(5(9)10)1-2-4(7)8/h2,10-12H,3-4H2,1H3;1-2H2,(H,7,8)(H,9,10) | [InChIKey]
MLAUVUHGQARGDU-UHFFFAOYSA-N | [SMILES]
C1(CO)=C(O)C(=NC=C1CO)C.C(CC(=O)O)C(=O)C(=O)O |
|
| Company Name: |
cjbscvictory
|
| Tel: |
13348960310 |
| Website: |
https://www.weikeqi-biotech.com/ |
| Company Name: |
Jingjingpharm
|
| Tel: |
15176975999;13831108726 |
| Website: |
https://www.jjpharm.cn |
|