| Identification | Back Directory | [Name]
(R)-1-Fluoro-2-propylamine Hydrochloride | [CAS]
273734-17-1 | [Synonyms]
(R)-1-fluoropropan-2-amine HCl (R)-1-Fluoropropan-2-amine hydrochloride (R)-1-Fluoro-2-propylamine Hydrochloride 2-Propanamine, 1-fluoro-, hydrochloride, (2R)- (R)-1-Fluoro-2-propylamine Hydrochloride ISO 9001:2015 REACH | [Molecular Formula]
C3H9ClFN | [MDL Number]
MFCD30188513 | [MOL File]
273734-17-1.mol | [Molecular Weight]
113.562 |
| Chemical Properties | Back Directory | [Melting point ]
123-124.5 °C | [storage temp. ]
Store at room temperature | [Appearance]
Light yellow to yellow Solid | [Optical Rotation]
Consistent with structure | [InChI]
InChI=1/C3H8FN.ClH/c1-3(5)2-4;/h3H,2,5H2,1H3;1H/t3-;/s3 | [InChIKey]
FHXAJBGANRCCBG-OQFXAWDINA-N | [SMILES]
N[C@H](C)CF.[H]Cl |&1:1,r| |
|
| Company Name: |
ShanghaiFineBiotechCoLtd
|
| Telephone: |
+8618717800556 18717800556 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList1118552/0_EN.htm |
|