| Identification | Back Directory | [Name]
benzyltoluene | [CAS]
27776-01-8 | [Synonyms]
Benzyltoluol benzyltoluene Neo SK-OIL 1300 Einecs 248-654-8 Methyl(phenylmethyl)benzene Benzene, methyl(phenylmethyl)- | [EINECS(EC#)]
248-654-8 | [Molecular Formula]
C14H14 | [MDL Number]
MFCD00048102 | [MOL File]
27776-01-8.mol | [Molecular Weight]
182.261 |
| Chemical Properties | Back Directory | [Appearance]
colourless to light yellow liquid | [Melting point ]
-55 °C | [Boiling point ]
125-128 °C(Press: 7 Torr) | [density ]
0.999[at 20℃] | [vapor pressure ]
0.66-1.33Pa at 20℃ | [Stability:]
Stable. Combustible. Incompatible with strong oxidizing agents. | [Water Solubility ]
3.7-3.97mg/L at 20℃ | [InChI]
InChI=1S/C14H14/c1-12-7-9-14(10-8-12)11-13-5-3-2-4-6-13/h2-10H,11H2,1H3 | [InChIKey]
SIYISNUJKMAQBV-UHFFFAOYSA-N | [SMILES]
C1(=CC=C(C)C=C1)CC1C=CC=CC=1 | [LogP]
4.35-4.935 at 20-25℃ | [EPA Substance Registry System]
Benzyltoluene (27776-01-8) |
|
| Company Name: |
BOC Sciences
|
| Tel: |
16314854226 |
| Website: |
www.bocsci.com |
|