| Identification | Back Directory | [Name]
santin | [CAS]
27782-63-4 | [Synonyms]
santin 3,4',6-Trimethoxy-5,7-dihydroxyflavone 5,7-Dihydroxy-3,6,4'-trimethoxyflavone 6-Hydroxykaempferol 3,4',6-trimethyl ether 2-(4-Methoxyphenyl)-5,7-dihydroxy-3,6-dimethoxy-4H-1-benzopyran-4-one 4H-1-Benzopyran-4-one, 5,7-dihydroxy-3,6-dimethoxy-2-(4-methoxyphenyl)- | [Molecular Formula]
C18H16O7 | [MDL Number]
MFCD07782268 | [MOL File]
27782-63-4.mol | [Molecular Weight]
344.32 |
| Chemical Properties | Back Directory | [Melting point ]
157-159 °C | [Boiling point ]
597.0±50.0 °C(Predicted) | [density ]
1.45±0.1 g/cm3(Predicted) | [form ]
Solid | [pka]
6.31±0.40(Predicted) | [color ]
Light yellow to yellow | [Major Application]
food and beverages | [InChI]
1S/C18H16O7/c1-22-10-6-4-9(5-7-10)16-18(24-3)15(21)13-12(25-16)8-11(19)17(23-2)14(13)20/h4-8,19-20H,1-3H3 | [InChIKey]
DWZAJFZEYZIHPO-UHFFFAOYSA-N | [SMILES]
[o]1c2c([c](c(c1c3ccc(cc3)OC)OC)=O)c(c(c(c2)O)OC)O |
| Hazard Information | Back Directory | [Uses]
food and beverages | [Definition]
ChEBI: A trimethoxyflavone that is flavone substituted by methoxy groups at positions 3, 6 and 4' and hydroxy groups at positions 5 and 7 respectively. |
|
| Company Name: |
BOC Sciences
|
| Tel: |
1-631-485-4226; 16314854226 |
| Website: |
https://www.bocsci.com |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|