| Identification | Back Directory | [Name]
(4-(3,6- diphenyl-9H- carbazol-9- yl)butyl)phos phonic | [CAS]
2814500-04-2 | [Synonyms]
Ph-4PACz
(4-(3,6- diphenyl-9H- carbazol-9- yl)butyl)phos phonic
(4-(3,6-diphenyl-9H-carbazol-9-yl)butyl)phosphonic acid | [Molecular Formula]
C28H26NO3P | [MOL File]
2814500-04-2.mol | [Molecular Weight]
455.49 |
| Chemical Properties | Back Directory | [storage temp. ]
Store at room temperature | [form ]
solid | [Appearance]
White to light brown Solid | [InChIKey]
JUZXTPFZIJMYBS-UHFFFAOYSA-N | [SMILES]
C1=CC=C(C=C1)C2=CC3=C(C=C2)N(C4=C3C=C(C=C4)C5=CC=CC=C5)CCCCP(=O)(O)O |
| Hazard Information | Back Directory | [Uses]
Ph-4PACz (4-Phenyl-4-phenyl-1,3-diazole) is a small molecule recognized for its ability to facilitate efficient charge transport, making it a valuable material in various organic electronic applications. This molecule is recognized for its efficient charge transport properties, making it a valuable candidate for various organic electronic applications. |
|
|