| Identification | Back Directory | [Name]
GLYCINE-2,2-D2-N-FMOC | [CAS]
284665-11-8 | [Synonyms]
FMoc-[D2]Gly-OH Glycine-d2-N-FMOC Fmoc-α-d2-glycine fmoc-gly-oh-2,2-d2 GLYCINE-2,2-D2-N-FMOC Glycine-2,2-D2-N-t-FMOC GLYCINE-N-FMOC (2,2-D2) N-(9-FluorenylMethoxycarbonyl)glycine-2 N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE-2,2-D2 N-(9-FLUORENYLMETHOXYCARBONYL)GLYCINE-2, 2-D2, 98 ATOM % D 2-({[(9H-fluoren-9-yl)methoxy]carbonyl}amino)(2H?)acetic acid 2,2-dideuterio-2-(9H-fluoren-9-ylmethoxycarbonylamino)acetic acid Glycine-2,2-d2, N-Fmoc, N-(9-Fluorenylmethoxycarbonyl)-glycine-2,2-d2 | [Molecular Formula]
C17H15NO4 | [MDL Number]
MFCD01075436 | [MOL File]
284665-11-8.mol | [Molecular Weight]
297.31 |
| Chemical Properties | Back Directory | [Melting point ]
174-175 °C(lit.) | [storage temp. ]
2-8°C | [form ]
Solid | [color ]
White to off-white | [Major Application]
peptide synthesis | [InChI]
1S/C17H15NO4/c19-16(20)9-18-17(21)22-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15H,9-10H2,(H,18,21)(H,19,20)/i9D2 | [InChIKey]
NDKDFTQNXLHCGO-KNXIQCGSSA-N | [SMILES]
[2H]C([2H])(NC(=O)OCC1c2ccccc2-c3ccccc13)C(O)=O | [CAS Number Unlabeled]
29022-11-5 |
| Hazard Information | Back Directory | [Uses]
Isotope labelled N-Fmoc-glycine is an N-Fmoc-protected form of Glycine (G615990). Glycine is a nonessential amino acid that acts as an inhibitory neyrotransmitter in the vertebrate central nervous system. Glycine also posesses cytoprotective against oxidant damage in the kidney. |
|
| Company Name: |
SynAsst Chemical.
|
| Telephone: |
021-60343070 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList15848/0_EN.htm |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shanghai GL Peptide Ltd.
|
| Telephone: |
+86-21-61263310 13764994101 |
| Website: |
www.chemicalbook.com/supplier/10480342/ |
| Company Name: |
Nextpeptide Inc
|
| Telephone: |
+86-0571-81612335 +8613336028439 |
| Website: |
http://www.nextpeptide.com/ |
| Company Name: |
GL Biochem(Binhai) Ltd.
|
| Telephone: |
+86-021-61263370 15301650015 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList415547/0_EN.htm |
| Company Name: |
Binhai gill polypeptide co. LTD
|
| Telephone: |
021-61263389 13524856427 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList326362/0_EN.htm |
|