| Chemical Properties | Back Directory | [Melting point ]
-27 °C(lit.) | [Boiling point ]
214 °C(lit.) | [density ]
1.162 g/mL at 25 °C | [Fp ]
93 °C | [InChI]
1S/C3H8O2/c4-2-1-3-5/h4-5H,1-3H2/i1D2,2D2,3D2,4D,5D | [InChIKey]
YPFDHNVEDLHUCE-JVKIUYSHSA-N | [SMILES]
[2H]OC([2H])([2H])C([2H])([2H])C([2H])([2H])O[2H] |
| Hazard Information | Back Directory | [Uses]
1,3-Propanediol-d8 is the labelled version of 1,3-Propanediol (P760320), which is a common organic reagent used in the synthesis of polymers and used in industrial organic chemistry for the synthesis of lubricants, foods, medicines and cosmetics. |
|
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|