| Identification | Back Directory | [Name]
2,5-Dibromo-3-isopropyl-6-methylbenzoquinone | [CAS]
29096-93-3 | [Synonyms]
DBMIB DIBROMOTHYMOQUINONE 2,5-dibromo-3-isopropyl-6-methylbenzoquinone 2,5-dibromo-3-methyl-6-isopropyl-p-benzoquinone 2,5-Dibromo-3-isopropyl-6-methyl-p-benzoquinone 2,5-DIBROMO-6-ISOPROPYL-3-METHYL-1,4-BENZOQUINONE 2,5-dibromo-3-methyl-6-propan-2-ylcyclohexa-2,5-diene-1,4-dione 2,5-Dibromo-3-methyl-6-(1-methylethyl)-2,5-cyclohexadiene-1,4-dione 2,5-Cyclohexadiene-1,4-dione, 2,5-dibromo-3-methyl-6-(1-methylethyl)- 2,5-Dibromo-3-methyl-6-isopropyl-p-benzoquinone, Dibromothymoquinone | [EINECS(EC#)]
249-431-8 | [Molecular Formula]
C10H10Br2O2 | [MDL Number]
MFCD00009967 | [MOL File]
29096-93-3.mol | [Molecular Weight]
321.99 |
| Chemical Properties | Back Directory | [Melting point ]
70-72 °C(lit.)
| [Boiling point ]
318.0±42.0 °C(Predicted) | [density ]
1.800±0.06 g/cm3(Predicted) | [storage temp. ]
room temp | [form ]
powder, crystals or chunks | [Major Application]
diagnostic assay manufacturing hematology histology | [InChI]
1S/C10H10Br2O2/c1-4(2)6-8(12)9(13)5(3)7(11)10(6)14/h4H,1-3H3 | [InChIKey]
GHHZELQYJPWSMG-UHFFFAOYSA-N | [SMILES]
CC(C)C1=C(Br)C(=O)C(C)=C(Br)C1=O |
| Hazard Information | Back Directory | [Uses]
2,?5-?Dibromo-?6-?isopropyl-?3-?methyl-?1,?4-?benzoquinone acts as an inhibitor of respiratory and photosynthetic processes. Dyes and metabolites. | [Definition]
ChEBI: Dibromothymoquinone is a member of 1,4-benzoquinones. It has a role as a cytochrome-b6f complex inhibitor. | [Biological Activity]
25-Dibromo-6-isopropyl-3-methyl-14-benzoquinone acts as an inhibitor of respiratory and photosynthetic processes. |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
China Langchem Inc.
|
| Tel: |
021-58956006,021-58950017 15800617331 |
| Website: |
www.isotopemall.com/ |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|