| Identification | Back Directory | [Name]
Lenalidomide Impurity 3 | [CAS]
295357-66-3 | [Synonyms]
Lenalidomide Impurity DA 2-(4-amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)glutaric acid 2-(4-Amino-1,3-dihydro-1-oxo-2H-isoindol-2-yl)pentanedioic acid | [Molecular Formula]
C13H14N2O5 | [MDL Number]
MFCD32644495 | [MOL File]
295357-66-3.mol | [Molecular Weight]
278.26 |
| Chemical Properties | Back Directory | [Boiling point ]
617.6±55.0 °C(Predicted) | [density ]
1.522±0.06 g/cm3(Predicted) | [pka]
3.51±0.10(Predicted) | [InChI]
InChI=1S/C13H14N2O5/c14-9-3-1-2-7-8(9)6-15(12(7)18)10(13(19)20)4-5-11(16)17/h1-3,10H,4-6,14H2,(H,16,17)(H,19,20) | [InChIKey]
DVFZIZCDDQITQV-UHFFFAOYSA-N | [SMILES]
C(O)(=O)C(N1CC2=C(C1=O)C=CC=C2N)CCC(O)=O |
|
|