| Identification | Back Directory | [Name]
N-(6-formyl-4-oxo-1H-pteridin-2-yl)acetamide | [CAS]
29769-49-1 | [Synonyms]
NSC 129965 2-Acetamido-6-formylpteridin-4-one N-(6-formyl-4-hydroxypteridin-2-yl)acetamide N-(6-formyl-4-oxo-1H-pteridin-2-yl)acetamide 2-AcetaMido-4-hydroxy-6-pteridinecarboxaldehyde N-(6-ForMyl-3,4-dihydro-4-oxo-2-pteridinyl)acetaMide Acetamide, N-(6-formyl-3,4-dihydro-4-oxo-2-pteridinyl)- | [Molecular Formula]
C9H7N5O3 | [MDL Number]
MFCD16251155 | [MOL File]
29769-49-1.mol | [Molecular Weight]
233.18 |
| Chemical Properties | Back Directory | [Melting point ]
>215°C (dec.) | [density ]
1.72±0.1 g/cm3(Predicted) | [storage temp. ]
Refrigerator | [solubility ]
DMSO, Methanol | [form ]
Solid | [pka]
7.45±0.20(Predicted) | [color ]
Tan | [InChI]
InChI=1S/C9H7N5O3/c1-4(16)11-9-13-7-6(8(17)14-9)12-5(3-15)2-10-7/h2-3H,1H3,(H2,10,11,13,14,16,17) | [InChIKey]
DDBCPKAHJKOGKK-UHFFFAOYSA-N | [SMILES]
C(NC1NC(=O)C2C(N=1)=NC=C(C=O)N=2)(=O)C |
| Hazard Information | Back Directory | [Chemical Properties]
Yellow Solid | [Uses]
pteridine derivative | [Definition]
ChEBI: N(2)-acetyl-6-formylpterin is pterin acetylated on N-2 and carrying a formyl group at position 6. | [Biological Activity]
Acetyl-6-formylpterin is involved in the enzymatic conversion of GTP to BH4playing a role in the regulation of neurotransmitter synthesis and other biological processes. |
|
| Company Name: |
Cool Pharm, Ltd
|
| Tel: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
| Company Name: |
Energy Chemical
|
| Tel: |
021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
|