| Identification | Back Directory | [Name]
3,3'-DISULFONATED-4,4'-DIFLUOROPHENYL SULFONE, DISODIUM SALT | [CAS]
301155-59-9 | [Synonyms]
Disodium 4,4'-difluorodiphenyl sulfone-3,3'-disulfonate 3,3'-DIsulfanted-4,4'-difluorophenyl sulfone, disodium salt 3,3'-DISULFONATED-4,4'-DIFLUOROPHENYL SULFONE, DISODIUM SALT Benzenesulfonic acid,3,3'-sulfonylbis[6-fluoro-, sodiuM salt (1:2) | [Molecular Formula]
C12H6F2Na2O8S3 | [MDL Number]
MFCD07787412 | [MOL File]
301155-59-9.mol | [Molecular Weight]
458.34 |
| Chemical Properties | Back Directory | [form ]
powder, crystals or chunks (solid) | [color ]
white to beige | [InChI]
InChI=1S/C12H8F2O8S3.2Na/c13-9-3-1-7(5-11(9)24(17,18)19)23(15,16)8-2-4-10(14)12(6-8)25(20,21)22;;/h1-6H,(H,17,18,19)(H,20,21,22);;/q;2*+1/p-2 | [SMILES]
O=S(C1=CC(S(=O)(O[Na])=O)=C(F)C=C1)(C2=CC=C(F)C(S(=O)(O[Na])=O)=C2)=O |
| Hazard Information | Back Directory | [Uses]
SDFDPS is specifically engineered for the synthesis of sulfonated polyarylene ether copolymers, which are utilized in various advanced applications, including proton exchange membrane (PEM) fuel cells. The high purity of SDFDPS ensures the successful formation of high molecular weight disulfonated poly(arylene ether sulfone) random or block copolymers, making it a vital component in the development of next-generation energy solutions. |
|
|