| Identification | Back Directory | [Name]
HYDROXYMETHYLSTYRENE | [CAS]
30584-69-1 | [Synonyms]
VINYLBENZYL ALCOHOL HYDROXYMETHYLSTYRENE ar-vinylbenzyl alcohol Benzenemethanol, ar-ethenyl Vinylbenzyl alcohol, mixture of isomers Vinylbenzylalcohol90%mixtureofisomersstabilized Vinylbenzyl alcohol, mixture of isomers, stabilized, 90% Vinylbenzyl alcohol, Mixture of isoMers, stabilized, 90% 5GR Vinylbenzyl Alcohol, Stabilized with p-tert-Butylpyrocatechol | [Molecular Formula]
C27H30O3 | [MDL Number]
MFCD04122937 | [MOL File]
30584-69-1.mol | [Molecular Weight]
402.53 |
| Chemical Properties | Back Directory | [Appearance]
clear yellow liquid | [Boiling point ]
207.3°C (rough estimate) | [density ]
0.9925 (rough estimate) | [refractive index ]
1.4934 (estimate) | [form ]
Liquid | [color ]
Clear colorless to yellow | [InChI]
InChI=1S/3C9H10O/c1-2-8-3-5-9(7-10)6-4-8;1-2-8-4-3-5-9(6-8)7-10;1-2-8-5-3-4-6-9(8)7-10/h3*2-6,10H,1,7H2 | [InChIKey]
VGQRISCOCOPGMA-UHFFFAOYSA-N | [SMILES]
C1(C=C)=CC=C(CO)C=C1.C1(C=C)=CC(CO)=CC=C1.C1(C=C)=CC=CC=C1CO | [CAS DataBase Reference]
30584-69-1 |
|
| Company Name: |
Spectrum Chemical Manufacturing Corp.
|
| Tel: |
021-021-021-67601398-809-809-809 15221380277 |
| Website: |
www.spectrumchemical.com/oa_html/index.jsp?minisite=10020&respid=22372&language=us |
| Company Name: |
Hubei DAHAO Chemical Co., Ltd.
|
| Tel: |
027-59106191 13986034860 |
| Website: |
https://www.chemicalbook.com/ShowSupplierProductsList329222/0_EN.htm |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Acros Organics
|
| Tel: |
+32 14/57.52.11 |
| Website: |
www.acros.be |
|