| Identification | Back Directory | [Name]
3,5-Dichloro-6-ethylpyrazinecarboxamide | [CAS]
313340-08-8 | [Synonyms]
3,5-Dichloro-6-ethylpyrazinecarboxamide 3,5-dichloro-6-ethyl-2-Pyrazinecarboxamide 3,5-Dichloro-6-ethylpyrazine-2-carboxaMide 2-Pyrazinecarboxamide, 3,5-dichloro-6-ethyl- 3,5-Dichloro-6-ethyl-pyrazine-2-carboxylic acid amide | [Molecular Formula]
C7H7Cl2N3O | [MDL Number]
MFCD27949199 | [MOL File]
313340-08-8.mol | [Molecular Weight]
220.06 |
| Chemical Properties | Back Directory | [Boiling point ]
271.3±40.0 °C(Predicted) | [density ]
1.454±0.06 g/cm3(Predicted) | [storage temp. ]
Inert atmosphere,2-8°C | [pka]
13.10±0.50(Predicted) | [InChI]
InChI=1S/C7H7Cl2N3O/c1-2-3-5(8)12-6(9)4(11-3)7(10)13/h2H2,1H3,(H2,10,13) | [InChIKey]
KMIXLCQPYRNBEH-UHFFFAOYSA-N | [SMILES]
C1(C(N)=O)=NC(CC)=C(Cl)N=C1Cl |
| Hazard Information | Back Directory | [Uses]
3,5-Dichloro-6-ethyl-2-pyrazinecarboxamide acts as a reagent in the preparation of nitrogen-containing heterocyclic derivatives as remedies for complications of diabetes. |
|
| Company Name: |
T&W GROUP
|
| Telephone: |
021-61551611 13296011611 |
| Website: |
www.trustwe.com/ |
| Company Name: |
Cool Pharm, Ltd
|
| Telephone: |
021-60455363 18019463053 |
| Website: |
www.coolpharm.com |
|