| Identification | Back Directory | [Name]
1-(4-Aminobutyl)-2-butyl-1H-imidazo[4,5-c]quinolin-4-amine | [CAS]
313350-31-1 | [Synonyms]
1H-Imidazo[4,5-c]quinoline-1-butanamine, 4-amino-2-butyl- 1-(4-Aminobutyl)-2-butyl-1H-imidazo[4,5-c]quinolin-4-amine | [Molecular Formula]
C18H25N5 | [MDL Number]
MFCD33398409 | [MOL File]
313350-31-1.mol | [Molecular Weight]
311.42 |
| Chemical Properties | Back Directory | [Boiling point ]
555.7±40.0 °C(Predicted) | [density ]
1.24±0.1 g/cm3(Predicted) | [storage temp. ]
RT, protect from light, stored under nitrogen | [pka]
10.36±0.10(Predicted) | [Appearance]
White to off-white Solid | [InChI]
InChI=1S/C18H25N5/c1-2-3-10-15-22-16-17(23(15)12-7-6-11-19)13-8-4-5-9-14(13)21-18(16)20/h4-5,8-9H,2-3,6-7,10-12,19H2,1H3,(H2,20,21) | [InChIKey]
IGZKWNHHWYBLOU-UHFFFAOYSA-N | [SMILES]
N1C2C(=CC=CC=2)C2N(CCCCN)C(CCCC)=NC=2C=1N |
| Hazard Information | Back Directory | [Uses]
1-(4-Aminobutyl)-2-butyl-1H-imidazo[4,5-c]quinolin-4-amine is an organic amine derivative that can be used in the preparation of antibody-drug conjugates (ADCs). |
|
| Company Name: |
Fuxin Pharmaceutical
|
| Telephone: |
+86-021-021-50872116 |
| Website: |
http://www.fuxinpharm.com |
| Company Name: |
Wuhan Topule
|
| Telephone: |
+86-02787215551 19945035818 |
| Website: |
http://www.topule.com/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|