| Identification | Back Directory | [Name]
Tetra(4-acetylphenyl)methane | [CAS]
313484-93-4 | [Synonyms]
TETRA(4-ACETYLPHENYL)METHANE tetrakis(4-acetylphenyl)methane Ethanone, 1,1',1'',1'''-(methanetetrayltetra-4,1-phenylene)tetrakis- 1,1',1'',1'''-(Methanetetrayltetrakis(benzene-4,1-diyl))tetraethanone | [Molecular Formula]
C33H28O4 | [MDL Number]
MFCD30531760 | [MOL File]
313484-93-4.mol | [Molecular Weight]
488.57 |
| Chemical Properties | Back Directory | [Boiling point ]
668.7±55.0 °C(Predicted) | [density ]
1.157±0.06 g/cm3(Predicted) | [InChI]
InChI=1S/C33H28O4/c1-21(34)25-5-13-29(14-6-25)33(30-15-7-26(8-16-30)22(2)35,31-17-9-27(10-18-31)23(3)36)32-19-11-28(12-20-32)24(4)37/h5-20H,1-4H3 | [InChIKey]
CAFYIOYXMUILEU-UHFFFAOYSA-N | [SMILES]
C(C1=CC=C(C(=O)C)C=C1)(C1=CC=C(C(=O)C)C=C1)(C1=CC=C(C(=O)C)C=C1)C1=CC=C(C(=O)C)C=C1 |
|
|