| Identification | Back Directory | [Name]
1-Naphthalenesulfonyl fluoride | [CAS]
317-55-5 | [Synonyms]
1-Naphthalenesulfonyl fluoride naphthalene-1-sulfonyl fluoride | [Molecular Formula]
C10H7FO2S | [MDL Number]
MFCD00457017 | [MOL File]
317-55-5.mol | [Molecular Weight]
210.22 |
| Chemical Properties | Back Directory | [Melting point ]
51-56 °C | [Boiling point ]
323.7±11.0 °C(Predicted) | [density ]
1.362±0.06 g/cm3(Predicted) | [form ]
solid | [InChI]
InChI=1S/C10H7FO2S/c11-14(12,13)10-7-3-5-8-4-1-2-6-9(8)10/h1-7H | [InChIKey]
MYKMYBMCWFRCHA-UHFFFAOYSA-N | [SMILES]
C1(S(F)(=O)=O)=C2C(C=CC=C2)=CC=C1 |
| Hazard Information | Back Directory | [Uses]
Sulfonyl fluoride motif can be used as a connector for the assembly of -SO2- linked small molecules with proteins or nucleic acids. This new click chemistry approach through sulfates is a complimentary approach to using amides and phosphate groups as linkers. | [reaction suitability]
reaction type: click chemistry |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|