| Identification | Back Directory | [Name]
N-[2-(Diphenylphosphino)benzylidene]cyclohexylamine, 97% | [CAS]
321155-13-9 | [Synonyms]
N-[2-(DIPHENYLPHOSPHINO)BENZYLIDENE]CYCLOHEXYLAMIN
N-[2-(Diphenylphosphino)benzylidene]cyclohexylamine, 97%
N-cyclohexyl-1-(2-(diphenylphosphanyl)phenyl)methanimine
Cyclohexanamine, N-[[2-(diphenylphosphino)phenyl]methylene]-
(NE)-N-{[2-(Diphenylphosphanyl)phenyl]-methylidene}cyclohexanamine | [Molecular Formula]
C25H26NP | [MDL Number]
MFCD16251547 | [MOL File]
321155-13-9.mol | [Molecular Weight]
371 |
| Chemical Properties | Back Directory | [Melting point ]
116-120°C | [form ]
solid | [InChI]
1S/C25H26NP/c1-4-13-22(14-5-1)26-20-21-12-10-11-19-25(21)27(23-15-6-2-7-16-23)24-17-8-3-9-18-24/h2-3,6-12,15-20,22H,1,4-5,13-14H2/b26-20+ | [InChIKey]
CWYDMJZWNROFGL-LHLOQNFPSA-N | [SMILES]
C1(P(C2=CC=CC=C2)C3=CC=CC=C3/C=N/C4CCCCC4)=CC=CC=C1 |
| Hazard Information | Back Directory | [Uses]
Catalyst for:
- Cross-coupling reactions
- Stannylative cycloaddition of conjugated enynes
- Stereo- and regioselective alkynylstannylation of alkynes
| [reaction suitability]
reaction type: Buchwald-Hartwig Cross Coupling Reaction
reaction type: Heck Reaction
reaction type: Hiyama Coupling
reaction type: Negishi Coupling
reaction type: Sonogashira Coupling
reaction type: Stille Coupling
reaction type: Suzuki-Miyaura Coupling
reagent type: ligand |
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Matrix Scientific
|
| Tel: |
803 788-9494 All other calls |
| Website: |
www.matrixscientific.com |
|