| Identification | Back Directory | [Name]
4-(3-PHENYLPROPYL)PYRIDINE N-OXIDE | [CAS]
34122-28-6 | [Synonyms]
4-PHENYLPROPYL PYRIDINE N-OXIDE 4-(3-PHENYLPROPYL)PYRIDINE N-OXIDE 4-(3-PHENYL-PROPYL)-PYRIDINE 1-OXIDE 4-(3-Phenylpropyl)pyridine N-oxide 95% Pyridine, 3-(3-phenylpropyl)-, 1-oxide | [Molecular Formula]
C14H15NO | [MDL Number]
MFCD00129033 | [MOL File]
34122-28-6.mol | [Molecular Weight]
213.27 |
| Chemical Properties | Back Directory | [Melting point ]
58-65 °C(lit.) | [Boiling point ]
397.6±11.0 °C(Predicted) | [density ]
1.02±0.1 g/cm3(Predicted) | [form ]
solid | [pka]
0.94±0.10(Predicted) | [InChI]
1S/C14H15NO/c16-15-11-9-14(10-12-15)8-4-7-13-5-2-1-3-6-13/h1-3,5-6,9-12H,4,7-8H2 | [InChIKey]
OOFBEJNEUVLZOW-UHFFFAOYSA-N | [SMILES]
[O-][n+]1ccc(CCCc2ccccc2)cc1 |
| Hazard Information | Back Directory | [Uses]
4-(3-Phenylpropyl)pyridine N-oxide may be employed as a donor ligand in the managnese-salen complex catalyzed asymmetric epoxidation of indene and styrene. | [General Description]
4-(3-Phenylpropyl)pyridine N-oxide (P3NO, 4-PPPyNO) participates in catalytic media for manganese-salen complex in the asymmetric epoxidation of indene. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
|