| Identification | Back Directory | [Name]
(1R)-(-)-DIMENTHYL SUCCINATE | [CAS]
34212-59-4 | [Synonyms]
(-)-Dimenthyl succinate (1R)-(-)-DIMENTHYL SUCCINATE (-)-DI[(1R)-MENTHYL] SUCCINATE (1R)-(-)-DIMENTHYL SUCCINATE-3 Succinic acid, di-(-)-menthyl ester Bis(2-isopropyl-5-methylcyclohexyl) succinate bis((1R,2S,5R)-2-isopropyl-5-Methylcyclohexyl) succinate Bis((1S,2R,5S)-2-isopropyl-5-methylcyclohexyl) succinate Butanedioic acid, 1,4-bis[(1R,2S,5R)-5-methyl-2-(1-methylethyl)cyclohexyl] ester 2-methyl-5-(propan-2-yl)cyclohexyl 5-methyl-2-(propan-2-yl)cyclohexyl butanedioate | [Molecular Formula]
C24H42O4 | [MDL Number]
MFCD00012281 | [MOL File]
34212-59-4.mol | [Molecular Weight]
394.59 |
| Chemical Properties | Back Directory | [Melting point ]
62-64 °C (lit.) | [Boiling point ]
200-205 °C/2 mmHg (lit.) | [density ]
0.9873 (rough estimate) | [refractive index ]
1.4460 (estimate) | [storage temp. ]
Storage temp. 2-8°C | [Appearance]
White to yellow Solid | [Optical Rotation]
[α]20/D 89°, c = 5 in chloroform | [BRN ]
3220135 | [InChI]
1S/C24H42O4/c1-15(2)19-9-7-17(5)13-21(19)27-23(25)11-12-24(26)28-22-14-18(6)8-10-20(22)16(3)4/h15-22H,7-14H2,1-6H3/t17-,18-,19+,20+,21-,22-/m1/s1 | [InChIKey]
YZXZAUAIVAZWFN-KQFPAPQFSA-N | [SMILES]
CC(C)[C@@H]1CC[C@@H](C)C[C@H]1OC(=O)CCC(=O)O[C@@H]2C[C@H](C)CC[C@H]2C(C)C | [LogP]
8.072 (est) |
| Hazard Information | Back Directory | [Uses]
(1R)-(?)-DiMenthyl succinate is used in the synthesis of antifungal agents and synthetic analogues.
| [Uses]
Dimethyl Succinate is used in the synthesis of antifungal agents and synthetic analogues. |
|
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
|