| Identification | Back Directory | [Name]
1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE | [CAS]
3505-67-7 | [Synonyms]
SPIRODILACTONE gamma-ketopimelic acid dilactone 4,4-DIHYDROXYPIMELIC ACID DILACTONE 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE 1,6-dioxaspiro[4.4]nonane-2,7-quinone 1,6-Dioxaspiro[4.4]nonane-2,7-dione 98% 4,4-Dihydroxypimelic acid dilactone, Spirodilactone | [EINECS(EC#)]
222-499-6 | [Molecular Formula]
C7H8O4 | [MDL Number]
MFCD00005531 | [MOL File]
3505-67-7.mol | [Molecular Weight]
156.14 |
| Chemical Properties | Back Directory | [Melting point ]
69-71 °C(lit.)
| [Boiling point ]
170 °C(Press: 1 Torr) | [density ]
1.36±0.1 g/cm3(Predicted) | [form ]
solid | [BRN ]
128330 | [InChI]
InChI=1S/C7H8O4/c8-5-1-3-7(10-5)4-2-6(9)11-7/h1-4H2 | [InChIKey]
VTQYOGUFKHVWOO-UHFFFAOYSA-N | [SMILES]
O1C2(CCC(=O)O2)CCC1=O |
| Hazard Information | Back Directory | [Uses]
1,6-Dioxaspiro[4.4]nonane-2,7-dione was used to cure diglycidylether of bisphenol A (DGEBA) with ytterbium triflate as initiator. |
| Spectrum Detail | Back Directory | [Spectrum Detail]
1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)MS 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)1HNMR 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)13CNMR 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)IR1 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)IR2 1,6-DIOXASPIRO[4.4]NONANE-2,7-DIONE(3505-67-7)Raman
|
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Shaanxi Dideu Medichem Co. Ltd
|
| Telephone: |
+86-029-81138252 +86-173 9270 1263 |
| Website: |
https://www.chemicalbook.com/manufacturer/shaanxi-dideu-medichem-222/ |
| Company Name: |
Bide Pharmatech Ltd.
|
| Telephone: |
400-1647117 13681763483 |
| Website: |
https://www.bidepharm.com/ |
|