| Identification | Back Directory | [Name]
TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)- | [CAS]
352525-91-8 | [Synonyms]
TRANS-2-(4-(TRIFLUOROMETHYL)PHENYL)-
(4-(TrifluoroMethyl)styryl)boronic acid
(E)-(4-(trifluoromethyl)styryl)boronic acid
{(E)-2-[4-(trifluoromethyl)phenyl]ethenyl}boronic acid
trans-2-[4-(Trifluoromethyl)phenyl]vinylboronic acid >=95%
Boronic acid, B-[(1E)-2-[4-(trifluoromethyl)phenyl]ethenyl]- | [Molecular Formula]
C9H8BF3O2 | [MDL Number]
MFCD03427005 | [MOL File]
352525-91-8.mol | [Molecular Weight]
215.96 |
| Chemical Properties | Back Directory | [Melting point ]
204-210 °C(lit.) | [Boiling point ]
307.948±52.00 °C(Press: 760.00 Torr)(predicted) | [density ]
1.314±0.06 g/cm3(Temp: 25 °C; Press: 760 Torr)(predicted) | [form ]
solid | [pka]
9.575±0.43(predicted) | [InChI]
1S/C9H8BF3O2/c11-9(12,13)8-3-1-7(2-4-8)5-6-10(14)15/h1-6,14-15H/b6-5+ | [InChIKey]
BBNQFBHQOPZKTI-AATRIKPKSA-N | [SMILES]
[H]\C(B(O)O)=C(\[H])c1ccc(cc1)C(F)(F)F |
| Hazard Information | Back Directory | [Uses]
Reactant for:
Microwave-assisted Suzuki-Miyaura cross-coupling
Cobalt-catalyzed coupling reactions
Preparation of vinylic MIDA boronates
Synthesis of C2-aryl pyrrolobenzodiazepine antitumor agents
Suzuki-Miyaura cross-coupling reaction | [Uses]
trans-2-[4-(Trifluoromethyl)phenyl]vinylboronic Acid is used in preparation of novel chromane, isochromane, thiochromane, or tetrahydroquinoline derivatives as glucosylceramide synthase (GCS) inhibitors. |
|
| Company Name: |
Energy Chemical
|
| Telephone: |
400-0056266 |
| Website: |
www.energy-chemical.com |
| Company Name: |
AllyChem Co., Ltd.
|
| Telephone: |
0411-62313318 13889470786 |
| Website: |
www.chemicalbook.com/showsupplierproductslist677/0_en.htm |
| Company Name: |
Sigma-Aldrich
|
| Telephone: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Telephone: |
0371-55051623 18137891487 |
| Website: |
www.chemicalbook.com/supplier/14555231/ |
|