| Identification | Back Directory | [Name]
TRIS(N N-BIS(TRIMETHYLSILYL)AMIDE)GADO& | [CAS]
35789-03-8 | [Synonyms]
Gadolinium bis(trimethylsilyl)amide GADOLINIUM TRIS(HEXAMETHYLDISILAZIDE) TRIS(N N-BIS(TRIMETHYLSILYL)AMIDE)GADO& Bis(trimethylsilyl)azanide,gadolinium(3+) TrisN,N-bis(trimethylsilyl)amideügadolinium(III), 98% | [Molecular Formula]
C18H54GdN3Si6 | [MDL Number]
MFCD03427091 | [MOL File]
35789-03-8.mol | [Molecular Weight]
638.412 |
| Chemical Properties | Back Directory | [Melting point ]
67-90 °C(lit.)
| [Fp ]
36 °F
| [form ]
solid | [Water Solubility ]
Soluble in water. | [Hydrolytic Sensitivity]
8: reacts rapidly with moisture, water, protic solvents | [Sensitive ]
Moisture Sensitive | [InChI]
1S/3C6H18NSi2.Gd/c3*1-8(2,3)7-9(4,5)6;/h3*1-6H3;/q3*-1;+3 | [InChIKey]
LFWPRLGQJJEPDP-UHFFFAOYSA-N | [SMILES]
C[Si](C)(C)N([Gd](N([Si](C)(C)C)[Si](C)(C)C)N([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| Hazard Information | Back Directory | [Uses]
Tris[N,N-bis(trimethylsilyl)amide]gadolinium(III) is used in many asymmetric catalysis applications, glove box and Schlenk techniques should be employed to prevent exposure of the rare earth catalyst to air and moisture, which can be detrimental to the reaction outcome. | [General Description]
Atomic number of base material: 64 Gadolinium | [reaction suitability]
core: gadolinium reagent type: catalyst |
|
| Company Name: |
Alfa Aesar
|
| Tel: |
400-6106006 |
| Website: |
http://chemicals.thermofisher.cn |
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Merck KGaA
|
| Tel: |
21-20338288 |
| Website: |
www.sigmaaldrich.cn |
| Company Name: |
Ereztech LLC
|
| Tel: |
1.888.658.1221 |
| Website: |
www.ereztech.com |
|