| Identification | Back Directory | [Name]
2'-(DIMETHYLAMINO)-2-BIPHENYLYL-PALLADIUM(II) CHLORIDE DINORBORNYLPHOSPHINE COMPLEX | [CAS]
359803-53-5 | [Synonyms]
SK-CC01-A 2'-(DIMETHYLAMINO)-2-BIPHENYLYL-PD(II)-CL DINORBORNYLPHOSPH. CHLORO-[2'-(DIMETHYLAMINO)-2-BIPHENYLYL]-(DINORBORNYLPHOSPHINE)-PALLADIUM CHLORO(DI-2-NORBORNYLPHOSPHINO)(2'-DIMETHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM CHLORO(DI-2-NORBORNYLPHOSPHINO)(2'-DIMETHYLAMINO-1,1'-BIPHENYL-2-YL)PALLADIUM(II) 2'-(Dimethylamino)-2-biphenyl-palladium(II)-chloride dinorbornylphosphine complex 2'-(Dimethylamino)-2-biphenylyl-palladium(Ⅱ) chloride dinorbornylphosphine complex 2'-(DIMETHYLAMINO)-2-BIPHENYLYL-PALLADIUM(II) CHLORIDE DINORBORNYLPHOSPHINE COMPLEX SK-CC01-A, Chloro-[2μ-(dimethylamino)-2-biphenylyl]-(dinorbornylphosphine)-palladium Chloro(di-2-norbornylphosphino)(2'-diMethylaMino-1,1'-biphenyl-2-yl)palladiuM(II),97% Chloro(di-2-norbornylphosphino)(2'-diMethylaMino-1,1'-biphenyl-2-yl)palladiuM(II) Min. Chloro(di-2-norbornylphosphino)(2'-dimethylamino-1,1'-biphenyl-2-yl)palladium(II),97%min. 2'-(Dimethylamino)-2-biphenylyl-palladium(II) chloride Dinorbornylphosphine complex >=99.0% (C) | [Molecular Formula]
C28H37ClNPPd | [MDL Number]
MFCD03427335 | [MOL File]
359803-53-5.mol | [Molecular Weight]
560.45 |
| Chemical Properties | Back Directory | [Melting point ]
160-170 °C (dec.)(lit.)
| [form ]
Powder | [color ]
beige | [InChIKey]
YMZCYRNVJBOOCT-SBADXZPPSA-M | [SMILES]
C1C[C@@H]2C[C@H]1CC2PC3C[C@@H]4CC[C@H]3C4.CN(C)c5ccccc5-c6ccccc6[Pd]Cl |
| Hazard Information | Back Directory | [Chemical Properties]
Light grey powder | [reaction suitability]
core: palladium reaction type: Buchwald-Hartwig Cross Coupling Reaction reaction type: Cross Couplings reaction type: Heck Reaction reaction type: Hiyama Coupling reaction type: Negishi Coupling reaction type: Sonogashira Coupling reaction type: Stille Coupling reaction type: Suzuki-Miyaura Coupling reagent type: catalyst |
| Questions And Answer | Back Directory | [Reactions]
A new, air and moisture-stable, palladium catalyst useful in a broad scope of C-C and C-N coupling reactions. The highlyactive catalyst can tolerate substrates containing a wide variety of functional groups such as alkyls, alkoxides, ketones, aldehydes, esters, amines, trifluoromethyl and nitro groups.
|
|
| Company Name: |
Energy Chemical
|
| Tel: |
021-021-58432009 400-005-6266 |
| Website: |
http://www.energy-chemical.com |
| Company Name: |
Sigma-Aldrich
|
| Tel: |
021-61415566 800-8193336 |
| Website: |
https://www.sigmaaldrich.cn |
| Company Name: |
Alfa Chemistry
|
| Tel: |
1-516-6625404 |
| Website: |
https://www.alfa-chemistry.com |
| Company Name: |
LaaJoo
|
| Tel: |
021-60702684 18516024827 |
| Website: |
www.chemicalbook.com/ShowSupplierProductsList20079/0_EN.htm |
| Company Name: |
Henan Alfachem Co.,Ltd.
|
| Tel: |
0371-55051623 18137891487 |
| Website: |
https://www.chemicalbook.com/supplier/14555231/ |
|