| Identification | Back Directory | [Name]
N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine | [CAS]
361486-60-4 | [Synonyms]
BF-DPB N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine N4,N4' -Bis(9,9-dimethyl-9H -fluoren-2-yl)-N4,N4'-diphenylbiphenyl-4,4'-diamine N4,N4,-bis(9,9-dimethyl-9H-fluoren-2-yl)-N4,N4,-diphenyl-[1,1,-biphenyl]-4,4,-diamine [1,1'-Biphenyl]-4,4'-diamine, N4,N4'-bis(9,9-dimethyl-9H-fluoren-2-yl)-N4,N4'-diphenyl- N,N'-Bis(9,9-dimethyl-9H-fluoren-2-yl)-N,N'-diphenylbenzidine | [Molecular Formula]
C54H44N2 | [MDL Number]
MFCD20528032 | [MOL File]
361486-60-4.mol | [Molecular Weight]
720.94 |
| Chemical Properties | Back Directory | [Melting point ]
264 °C | [density ]
1.178±0.06 g/cm3(Predicted) | [form ]
powder to crystal | [pka]
-2.49±0.40(Predicted) | [color ]
White to Orange to Green | [InChIKey]
VZYZZKOUCVXTOJ-UHFFFAOYSA-N | [SMILES]
C1(C2=CC=C(N(C3C=CC4C5=C(C(C)(C)C=4C=3)C=CC=C5)C3=CC=CC=C3)C=C2)=CC=C(N(C2C=CC3C4=C(C(C)(C)C=3C=2)C=CC=C4)C2=CC=CC=C2)C=C1 |
|
| Company Name: |
TCI Europe
|
| Tel: |
320-37350700 |
| Website: |
https://www.tcichemicals.com/de/de/index.html |
| Company Name: |
TCI AMERICA
|
| Tel: |
800-4238616 |
| Website: |
https://www.tcichemicals.com/en/us/index.html |
| Company Name: |
3A Chemicals
|
| Tel: |
400-668-9898 |
| Website: |
www.3achem.com |
| Company Name: |
TCI Chemicals
|
| Tel: |
021-67121386, 800-988-0390 |
| Website: |
www.tcichemicals.com |
|